C13H18O — CID 143921031
(3Z,6Z,7Z)-4-ethenyl-6-(methoxymethylidene)nona-1,3,7-triene (PubChem CID 143921031) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (3Z,6Z,7Z)-4-ethenyl-6-(methoxymethylidene)nona-1,3,7-triene.
| Compound Name | (3Z,6Z,7Z)-4-ethenyl-6-(methoxymethylidene)nona-1,3,7-triene |
|---|---|
| PubChem CID | 143921031 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (3Z,6Z,7Z)-4-ethenyl-6-(methoxymethylidene)nona-1,3,7-triene |
| SMILES | C=C/C=C(\C=C)CC(/C=C\C)=C/OC |
| InChI | InChI=1S/C13H18O/c1-5-8-12(7-3)10-13(9-6-2)11-14-4/h5-9,11H,1,3,10H2,2,4H3/b9-6-,12-8+,13-11+ |
| InChIKey | WCCQYIGXCAKFIY-JNJPKCOVSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|