C13H19F3 — CID 178040675
(2Z,4Z,6E)-4-ethyl-6-(2,2,2-trifluoroethyl)nona-2,4,6-triene (PubChem CID 178040675) has the molecular formula C13H19F3 and a molecular weight of 232.29 g/mol. Its IUPAC name is (2Z,4Z,6E)-4-ethyl-6-(2,2,2-trifluoroethyl)nona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E)-4-ethyl-6-(2,2,2-trifluoroethyl)nona-2,4,6-triene |
|---|---|
| PubChem CID | 178040675 |
| Molecular Formula | C13H19F3 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (2Z,4Z,6E)-4-ethyl-6-(2,2,2-trifluoroethyl)nona-2,4,6-triene |
| SMILES | C/C=C\C(=C/C(=C/CC)CC(F)(F)F)CC |
| InChI | InChI=1S/C13H19F3/c1-4-7-11(6-3)9-12(8-5-2)10-13(14,15)16/h4,7-9H,5-6,10H2,1-3H3/b7-4-,11-9-,12-8- |
| InChIKey | IDKWFJYUUASOBJ-SQKIHRKRSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|