C6H14N2O — CID 163903342
3-propoxyprop-1-ene-1,1-diamine (PubChem CID 163903342) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-propoxyprop-1-ene-1,1-diamine.
| Compound Name | 3-propoxyprop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 163903342 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 3-propoxyprop-1-ene-1,1-diamine |
| SMILES | CCCOCC=C(N)N |
| InChI | InChI=1S/C6H14N2O/c1-2-4-9-5-3-6(7)8/h3H,2,4-5,7-8H2,1H3 |
| InChIKey | QLTRYRWMLBGUIC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|