About (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol
(Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol (PubChem CID 142009179) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol |
| PubChem CID | 142009179 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol |
| SMILES | C/C=C(O)\C=C/COCCC.C/C=C\CC |
| InChI | InChI=1S/C9H16O2.C5H10/c1-3-7-11-8-5-6-9(10)4-2;1-3-5-4-2/h4-6,10H,3,7-8H2,1-2H3;3,5H,4H2,1-2H3/b6-5-,9-4+;5-3- |
| InChIKey | TVWCAGYMBJZXCH-QXDOCYOASA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol?
The IUPAC name of (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol (CID 142009179) is (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol.
What is the SMILES notation for (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol?
The canonical SMILES for (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol is C/C=C(O)\C=C/COCCC.C/C=C\CC.
What is the InChIKey of (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol?
The InChIKey is TVWCAGYMBJZXCH-QXDOCYOASA-N. The full InChI is InChI=1S/C9H16O2.C5H10/c1-3-7-11-8-5-6-9(10)4-2;1-3-5-4-2/h4-6,10H,3,7-8H2,1-2H3;3,5H,4H2,1-2H3/b6-5-,9-4+;5-3-.
What are the key properties of (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol?
(Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol has a molecular weight of 226.36 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-pent-2-ene;(2E,4Z)-6-propoxyhexa-2,4-dien-3-ol is sourced from PubChem (CID 142009179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).