C11H20O — CID 142891735
(3Z,5Z)-4-(2-methoxyethyl)octa-3,5-diene (PubChem CID 142891735) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3Z,5Z)-4-(2-methoxyethyl)octa-3,5-diene.
| Compound Name | (3Z,5Z)-4-(2-methoxyethyl)octa-3,5-diene |
|---|---|
| PubChem CID | 142891735 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3Z,5Z)-4-(2-methoxyethyl)octa-3,5-diene |
| SMILES | CC/C=C\C(=C/CC)CCOC |
| InChI | InChI=1S/C11H20O/c1-4-6-8-11(7-5-2)9-10-12-3/h6-8H,4-5,9-10H2,1-3H3/b8-6-,11-7+ |
| InChIKey | RKNMCMMGGFVTOH-FAWHLJIPSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|