About N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene
N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene (PubChem CID 178172448) has the molecular formula C13H31N
and a molecular weight of 201.40 g/mol. Its IUPAC name is N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene.
Molecular Properties
| Compound Name | N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene |
| PubChem CID | 178172448 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene |
| SMILES | C.C=CC.CCCCN(CC)CCC |
| InChI | InChI=1S/C9H21N.C3H6.CH4/c1-4-7-9-10(6-3)8-5-2;1-3-2;/h4-9H2,1-3H3;3H,1H2,2H3;1H4 |
| InChIKey | FWHWZOHASVJINO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene?
The IUPAC name of N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene (CID 178172448) is N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene.
What is the SMILES notation for N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene?
The canonical SMILES for N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene is C.C=CC.CCCCN(CC)CCC.
What is the InChIKey of N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene?
The InChIKey is FWHWZOHASVJINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C3H6.CH4/c1-4-7-9-10(6-3)8-5-2;1-3-2;/h4-9H2,1-3H3;3H,1H2,2H3;1H4.
What are the key properties of N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene?
N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene has a molecular weight of 201.40 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propylbutan-1-amine;methane;prop-1-ene is sourced from PubChem (CID 178172448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).