C11H17F3 — CID 142112959
ethene;(2Z,4Z)-3-ethyl-7,7,7-trifluorohepta-2,4-diene (PubChem CID 142112959) has the molecular formula C11H17F3 and a molecular weight of 206.25 g/mol. Its IUPAC name is ethene;(2Z,4Z)-3-ethyl-7,7,7-trifluorohepta-2,4-diene.
| Compound Name | ethene;(2Z,4Z)-3-ethyl-7,7,7-trifluorohepta-2,4-diene |
|---|---|
| PubChem CID | 142112959 |
| Molecular Formula | C11H17F3 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | ethene;(2Z,4Z)-3-ethyl-7,7,7-trifluorohepta-2,4-diene |
| SMILES | C/C=C(\C=C/CC(F)(F)F)CC.C=C |
| InChI | InChI=1S/C9H13F3.C2H4/c1-3-8(4-2)6-5-7-9(10,11)12;1-2/h3,5-6H,4,7H2,1-2H3;1-2H2/b6-5-,8-3-; |
| InChIKey | MEBSXURDJUYDOM-RFIDHEAQSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|