C14H24O2 — CID 143452524
(2Z,4Z)-2-ethenyl-4-propan-2-yl-3-propoxyhexa-2,4-dien-1-ol (PubChem CID 143452524) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-4-propan-2-yl-3-propoxyhexa-2,4-dien-1-ol.
| Compound Name | (2Z,4Z)-2-ethenyl-4-propan-2-yl-3-propoxyhexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143452524 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-4-propan-2-yl-3-propoxyhexa-2,4-dien-1-ol |
| SMILES | C=C/C(CO)=C(OCCC)\C(=C/C)C(C)C |
| InChI | InChI=1S/C14H24O2/c1-6-9-16-14(12(7-2)10-15)13(8-3)11(4)5/h7-8,11,15H,2,6,9-10H2,1,3-5H3/b13-8-,14-12- |
| InChIKey | CLYDVWPXUIEPFB-FTLKULPESA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|