C14H28O2 — CID 143452543
(Z)-2,5-dimethyl-4-methylidene-3-propoxyhex-2-en-1-ol;ethane (PubChem CID 143452543) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-4-methylidene-3-propoxyhex-2-en-1-ol;ethane.
| Compound Name | (Z)-2,5-dimethyl-4-methylidene-3-propoxyhex-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 143452543 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (Z)-2,5-dimethyl-4-methylidene-3-propoxyhex-2-en-1-ol;ethane |
| SMILES | C=C(/C(OCCC)=C(\C)CO)C(C)C.CC |
| InChI | InChI=1S/C12H22O2.C2H6/c1-6-7-14-12(10(4)8-13)11(5)9(2)3;1-2/h9,13H,5-8H2,1-4H3;1-2H3/b12-10-; |
| InChIKey | APGOEUZFTNKIOC-BBJSDXRSSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|