C20H34OS2 — CID 144667398
(3Z)-3-ethylhexa-1,3,5-triene;2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol (PubChem CID 144667398) has the molecular formula C20H34OS2 and a molecular weight of 354.63 g/mol. Its IUPAC name is (3Z)-3-ethylhexa-1,3,5-triene;2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol.
| Compound Name | (3Z)-3-ethylhexa-1,3,5-triene;2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol |
|---|---|
| PubChem CID | 144667398 |
| Molecular Formula | C20H34OS2 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3Z)-3-ethylhexa-1,3,5-triene;2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol |
| SMILES | C=C/C=C(/CC)C(CCC)SSCCO.C=C/C=C(\C=C)CC |
| InChI | InChI=1S/C12H22OS2.C8H12/c1-4-7-11(6-3)12(8-5-2)15-14-10-9-13;1-4-7-8(5-2)6-3/h4,7,12-13H,1,5-6,8-10H2,2-3H3;4-5,7H,1-2,6H2,3H3/b11-7-;8-7+ |
| InChIKey | QLNHQUATHQBLKO-VDZNTLAZSA-N |
| XLogP | 6.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|