C7H14O4S — CID 176806136
S-(2-hydroxyethyl) 2-(2-methoxyethoxy)ethanethioate (PubChem CID 176806136) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is S-(2-hydroxyethyl) 2-(2-methoxyethoxy)ethanethioate.
| Compound Name | S-(2-hydroxyethyl) 2-(2-methoxyethoxy)ethanethioate |
|---|---|
| PubChem CID | 176806136 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | S-(2-hydroxyethyl) 2-(2-methoxyethoxy)ethanethioate |
| SMILES | COCCOCC(=O)SCCO |
| InChI | InChI=1S/C7H14O4S/c1-10-3-4-11-6-7(9)12-5-2-8/h8H,2-6H2,1H3 |
| InChIKey | XLNHOHPUFXHFOZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|