C15H24 — CID 123858156
8-ethylidene-3-methyldodeca-2,4,9-triene (PubChem CID 123858156) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 8-ethylidene-3-methyldodeca-2,4,9-triene.
| Compound Name | 8-ethylidene-3-methyldodeca-2,4,9-triene |
|---|---|
| PubChem CID | 123858156 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 8-ethylidene-3-methyldodeca-2,4,9-triene |
| SMILES | CC=C(C)C=CCCC(C=CCC)=CC |
| InChI | InChI=1S/C15H24/c1-5-8-12-15(7-3)13-10-9-11-14(4)6-2/h6-9,11-12H,5,10,13H2,1-4H3 |
| InChIKey | AIRNWRROWBPZHF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|