C13H25N — CID 134424615
(5Z,7Z)-N,N,6-trimethyldeca-5,7-dien-5-amine (PubChem CID 134424615) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (5Z,7Z)-N,N,6-trimethyldeca-5,7-dien-5-amine.
| Compound Name | (5Z,7Z)-N,N,6-trimethyldeca-5,7-dien-5-amine |
|---|---|
| PubChem CID | 134424615 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (5Z,7Z)-N,N,6-trimethyldeca-5,7-dien-5-amine |
| SMILES | CC/C=C\C(C)=C(\CCCC)N(C)C |
| InChI | InChI=1S/C13H25N/c1-6-8-10-12(3)13(14(4)5)11-9-7-2/h8,10H,6-7,9,11H2,1-5H3/b10-8-,13-12- |
| InChIKey | NPZBIKCVEIWHSR-OCACNAFOSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|