C8H12FNO — CID 88587086
(2Z,4Z)-3-fluoro-4-methyl-2-nitrosohepta-2,4-diene (PubChem CID 88587086) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (2Z,4Z)-3-fluoro-4-methyl-2-nitrosohepta-2,4-diene.
| Compound Name | (2Z,4Z)-3-fluoro-4-methyl-2-nitrosohepta-2,4-diene |
|---|---|
| PubChem CID | 88587086 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2Z,4Z)-3-fluoro-4-methyl-2-nitrosohepta-2,4-diene |
| SMILES | CC/C=C(C)\C(F)=C(/C)N=O |
| InChI | InChI=1S/C8H12FNO/c1-4-5-6(2)8(9)7(3)10-11/h5H,4H2,1-3H3/b6-5-,8-7- |
| InChIKey | HZKMFZBSWJJLJT-ISTTXYCBSA-N |
| XLogP | 3.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|