C13H23FN2O — CID 143883697
N'-[(1Z,3E)-1-ethoxy-2-fluoro-3-methylhexa-1,3-dienyl]-N,N-dimethylethanimidamide (PubChem CID 143883697) has the molecular formula C13H23FN2O and a molecular weight of 242.34 g/mol. Its IUPAC name is N'-[(1Z,3E)-1-ethoxy-2-fluoro-3-methylhexa-1,3-dienyl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[(1Z,3E)-1-ethoxy-2-fluoro-3-methylhexa-1,3-dienyl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 143883697 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N'-[(1Z,3E)-1-ethoxy-2-fluoro-3-methylhexa-1,3-dienyl]-N,N-dimethylethanimidamide |
| SMILES | CC/C=C(C)/C(F)=C(\N=C(/C)N(C)C)OCC |
| InChI | InChI=1S/C13H23FN2O/c1-7-9-10(3)12(14)13(17-8-2)15-11(4)16(5)6/h9H,7-8H2,1-6H3/b10-9+,13-12-,15-11+ |
| InChIKey | WPLQPPHQHDDOST-IDHCKHCCSA-N |
| XLogP | 3.50 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|