C15H21F — CID 130420883
(3E,5E)-3-ethenyl-5-(1-fluoroprop-2-enyl)-2,4-dimethylocta-1,3,5-triene (PubChem CID 130420883) has the molecular formula C15H21F and a molecular weight of 220.33 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-5-(1-fluoroprop-2-enyl)-2,4-dimethylocta-1,3,5-triene.
| Compound Name | (3E,5E)-3-ethenyl-5-(1-fluoroprop-2-enyl)-2,4-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 130420883 |
| Molecular Formula | C15H21F |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (3E,5E)-3-ethenyl-5-(1-fluoroprop-2-enyl)-2,4-dimethylocta-1,3,5-triene |
| SMILES | C=C/C(C(=C)C)=C(C)\C(=C/CC)C(F)C=C |
| InChI | InChI=1S/C15H21F/c1-7-10-14(15(16)9-3)12(6)13(8-2)11(4)5/h8-10,15H,2-4,7H2,1,5-6H3/b13-12+,14-10+ |
| InChIKey | PAQUWIABYQXQPQ-GTDMLIFZSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|