C18H34 — CID 145382285
(3E,5Z)-3-tert-butyl-4,5-dimethylocta-1,3,5-triene;2-methylpropane (PubChem CID 145382285) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is (3E,5Z)-3-tert-butyl-4,5-dimethylocta-1,3,5-triene;2-methylpropane.
| Compound Name | (3E,5Z)-3-tert-butyl-4,5-dimethylocta-1,3,5-triene;2-methylpropane |
|---|---|
| PubChem CID | 145382285 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (3E,5Z)-3-tert-butyl-4,5-dimethylocta-1,3,5-triene;2-methylpropane |
| SMILES | C=C/C(=C(C)\C(C)=C/CC)C(C)(C)C.CC(C)C |
| InChI | InChI=1S/C14H24.C4H10/c1-8-10-11(3)12(4)13(9-2)14(5,6)7;1-4(2)3/h9-10H,2,8H2,1,3-7H3;4H,1-3H3/b11-10-,13-12+; |
| InChIKey | CIRRIHVCNURYPB-LDECQCHSSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|