C18H34 — CID 91100441
4,7,7,9-tetramethyl-5-propan-2-ylundeca-3,5-diene (PubChem CID 91100441) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 4,7,7,9-tetramethyl-5-propan-2-ylundeca-3,5-diene.
| Compound Name | 4,7,7,9-tetramethyl-5-propan-2-ylundeca-3,5-diene |
|---|---|
| PubChem CID | 91100441 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 4,7,7,9-tetramethyl-5-propan-2-ylundeca-3,5-diene |
| SMILES | CCC=C(C)C(=CC(C)(C)CC(C)CC)C(C)C |
| InChI | InChI=1S/C18H34/c1-9-11-16(6)17(14(3)4)13-18(7,8)12-15(5)10-2/h11,13-15H,9-10,12H2,1-8H3 |
| InChIKey | WGJQRCUKMJOWMU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|