C9H16O — CID 172570769
(2Z,5E)-5-methylocta-2,5-dien-4-ol (PubChem CID 172570769) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (2Z,5E)-5-methylocta-2,5-dien-4-ol.
| Compound Name | (2Z,5E)-5-methylocta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 172570769 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (2Z,5E)-5-methylocta-2,5-dien-4-ol |
| SMILES | C/C=C\C(O)/C(C)=C/CC |
| InChI | InChI=1S/C9H16O/c1-4-6-8(3)9(10)7-5-2/h5-7,9-10H,4H2,1-3H3/b7-5-,8-6+ |
| InChIKey | GYQYKWRVMRSRII-CGXWXWIYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|