About (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal
(Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal (PubChem CID 143343622) has the molecular formula C11H19BrO
and a molecular weight of 247.18 g/mol. Its IUPAC name is (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal.
Molecular Properties
| Compound Name | (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal |
| PubChem CID | 143343622 |
| Molecular Formula | C11H19BrO |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal |
| SMILES | C/C=C\C(C)Br.CC/C=C(\C)C=O |
| InChI | InChI=1S/C6H10O.C5H9Br/c1-3-4-6(2)5-7;1-3-4-5(2)6/h4-5H,3H2,1-2H3;3-5H,1-2H3/b6-4+;4-3- |
| InChIKey | VHXZJDFAKWRYEF-DNPFMGSFSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal?
The IUPAC name of (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal (CID 143343622) is (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal.
What is the SMILES notation for (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal?
The canonical SMILES for (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal is C/C=C\C(C)Br.CC/C=C(\C)C=O.
What is the InChIKey of (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal?
The InChIKey is VHXZJDFAKWRYEF-DNPFMGSFSA-N. The full InChI is InChI=1S/C6H10O.C5H9Br/c1-3-4-6(2)5-7;1-3-4-5(2)6/h4-5H,3H2,1-2H3;3-5H,1-2H3/b6-4+;4-3-.
What are the key properties of (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal?
(Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal has a molecular weight of 247.18 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-bromopent-2-ene;(E)-2-methylpent-2-enal is sourced from PubChem (CID 143343622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).