C9H18O — CID 88722720
(E)-2,5-dimethylhept-2-en-1-ol (PubChem CID 88722720) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (E)-2,5-dimethylhept-2-en-1-ol.
| Compound Name | (E)-2,5-dimethylhept-2-en-1-ol |
|---|---|
| PubChem CID | 88722720 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (E)-2,5-dimethylhept-2-en-1-ol |
| SMILES | CCC(C)C/C=C(\C)CO |
| InChI | InChI=1S/C9H18O/c1-4-8(2)5-6-9(3)7-10/h6,8,10H,4-5,7H2,1-3H3/b9-6+ |
| InChIKey | CLYCUTLAMWFSRL-RMKNXTFCSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|