C13H26O — CID 143524733
(E)-2,5,8-trimethyldec-5-en-3-ol (PubChem CID 143524733) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (E)-2,5,8-trimethyldec-5-en-3-ol.
| Compound Name | (E)-2,5,8-trimethyldec-5-en-3-ol |
|---|---|
| PubChem CID | 143524733 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (E)-2,5,8-trimethyldec-5-en-3-ol |
| SMILES | CCC(C)C/C=C(\C)CC(O)C(C)C |
| InChI | InChI=1S/C13H26O/c1-6-11(4)7-8-12(5)9-13(14)10(2)3/h8,10-11,13-14H,6-7,9H2,1-5H3/b12-8+ |
| InChIKey | LVAMZHKTNUAMDV-XYOKQWHBSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|