C12H24O2 — CID 142862016
(E,2R)-2-hydroperoxy-4,7-dimethyldec-4-ene (PubChem CID 142862016) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (E,2R)-2-hydroperoxy-4,7-dimethyldec-4-ene.
| Compound Name | (E,2R)-2-hydroperoxy-4,7-dimethyldec-4-ene |
|---|---|
| PubChem CID | 142862016 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (E,2R)-2-hydroperoxy-4,7-dimethyldec-4-ene |
| SMILES | CCCC(C)C/C=C(\C)C[C@@H](C)OO |
| InChI | InChI=1S/C12H24O2/c1-5-6-10(2)7-8-11(3)9-12(4)14-13/h8,10,12-13H,5-7,9H2,1-4H3/b11-8+/t10?,12-/m1/s1 |
| InChIKey | UOFAVKFWSGPFGE-XWJHTDAVSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|