About 3-methylpentanethial
3-methylpentanethial (PubChem CID 18959784) has the molecular formula C6H12S
and a molecular weight of 116.23 g/mol. Its IUPAC name is 3-methylpentanethial.
Molecular Properties
| Compound Name | 3-methylpentanethial |
| PubChem CID | 18959784 |
| Molecular Formula | C6H12S |
| Molecular Weight | 116.23 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 3-methylpentanethial |
| SMILES | CCC(C)CC=S |
| InChI | InChI=1S/C6H12S/c1-3-6(2)4-5-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | NPWQOUZEZHPCDV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentanethial?
The IUPAC name of 3-methylpentanethial (CID 18959784) is 3-methylpentanethial.
What is the SMILES notation for 3-methylpentanethial?
The canonical SMILES for 3-methylpentanethial is CCC(C)CC=S.
What is the InChIKey of 3-methylpentanethial?
The InChIKey is NPWQOUZEZHPCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S/c1-3-6(2)4-5-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-methylpentanethial?
3-methylpentanethial has a molecular weight of 116.23 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentanethial is sourced from PubChem (CID 18959784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).