About methane;3-methylpentane;tritioethyne
methane;3-methylpentane;tritioethyne (PubChem CID 159244363) has the molecular formula C9H20
and a molecular weight of 130.27 g/mol. Its IUPAC name is methane;3-methylpentane;tritioethyne.
Molecular Properties
| Compound Name | methane;3-methylpentane;tritioethyne |
| PubChem CID | 159244363 |
| Molecular Formula | C9H20 |
| Molecular Weight | 130.27 g/mol |
| Exact Mass | 130.16 |
| IUPAC Name | methane;3-methylpentane;tritioethyne |
| SMILES | C.CCC(C)CC.[3H]C#C |
| InChI | InChI=1S/C6H14.C2H2.CH4/c1-4-6(3)5-2;1-2;/h6H,4-5H2,1-3H3;1-2H;1H4/i;1T; |
| InChIKey | KUMOICCXKAISIP-RZBWRYPDSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;3-methylpentane;tritioethyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylpentane;tritioethyne?
The IUPAC name of methane;3-methylpentane;tritioethyne (CID 159244363) is methane;3-methylpentane;tritioethyne.
What is the SMILES notation for methane;3-methylpentane;tritioethyne?
The canonical SMILES for methane;3-methylpentane;tritioethyne is C.CCC(C)CC.[3H]C#C.
What is the InChIKey of methane;3-methylpentane;tritioethyne?
The InChIKey is KUMOICCXKAISIP-RZBWRYPDSA-N. The full InChI is InChI=1S/C6H14.C2H2.CH4/c1-4-6(3)5-2;1-2;/h6H,4-5H2,1-3H3;1-2H;1H4/i;1T;.
What are the key properties of methane;3-methylpentane;tritioethyne?
methane;3-methylpentane;tritioethyne has a molecular weight of 130.27 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylpentane;tritioethyne is sourced from PubChem (CID 159244363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).