C12H24O2 — CID 87272716
(E)-5-methoxy-2,7-dimethylnon-2-en-1-ol (PubChem CID 87272716) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (E)-5-methoxy-2,7-dimethylnon-2-en-1-ol.
| Compound Name | (E)-5-methoxy-2,7-dimethylnon-2-en-1-ol |
|---|---|
| PubChem CID | 87272716 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (E)-5-methoxy-2,7-dimethylnon-2-en-1-ol |
| SMILES | CCC(C)CC(C/C=C(\C)CO)OC |
| InChI | InChI=1S/C12H24O2/c1-5-10(2)8-12(14-4)7-6-11(3)9-13/h6,10,12-13H,5,7-9H2,1-4H3/b11-6+ |
| InChIKey | LKSCZUGUYCTZMA-IZZDOVSWSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|