C9H20N2 — CID 174281685
(Z,5S)-4-ethyl-2-N-methylhex-2-ene-2,5-diamine (PubChem CID 174281685) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (Z,5S)-4-ethyl-2-N-methylhex-2-ene-2,5-diamine.
| Compound Name | (Z,5S)-4-ethyl-2-N-methylhex-2-ene-2,5-diamine |
|---|---|
| PubChem CID | 174281685 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (Z,5S)-4-ethyl-2-N-methylhex-2-ene-2,5-diamine |
| SMILES | CCC(/C=C(/C)NC)[C@H](C)N |
| InChI | InChI=1S/C9H20N2/c1-5-9(8(3)10)6-7(2)11-4/h6,8-9,11H,5,10H2,1-4H3/b7-6-/t8-,9?/m0/s1 |
| InChIKey | YAPFWWRMWVSZEP-JPVSOYJMSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |