C10H21N — CID 167060991
(Z)-N,3,5-trimethylhept-4-en-1-amine (PubChem CID 167060991) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is (Z)-N,3,5-trimethylhept-4-en-1-amine.
| Compound Name | (Z)-N,3,5-trimethylhept-4-en-1-amine |
|---|---|
| PubChem CID | 167060991 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (Z)-N,3,5-trimethylhept-4-en-1-amine |
| SMILES | CC/C(C)=C\C(C)CCNC |
| InChI | InChI=1S/C10H21N/c1-5-9(2)8-10(3)6-7-11-4/h8,10-11H,5-7H2,1-4H3/b9-8- |
| InChIKey | LMXRDUYKSBGACY-HJWRWDBZSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|