C10H23N — CID 144566513
(E)-N,4-dimethylhex-3-en-1-amine;ethane (PubChem CID 144566513) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is (E)-N,4-dimethylhex-3-en-1-amine;ethane.
| Compound Name | (E)-N,4-dimethylhex-3-en-1-amine;ethane |
|---|---|
| PubChem CID | 144566513 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | (E)-N,4-dimethylhex-3-en-1-amine;ethane |
| SMILES | CC.CC/C(C)=C/CCNC |
| InChI | InChI=1S/C8H17N.C2H6/c1-4-8(2)6-5-7-9-3;1-2/h6,9H,4-5,7H2,1-3H3;1-2H3/b8-6+; |
| InChIKey | NXILKTBYYIFISB-WVLIHFOGSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|