C10H22N2 — CID 91413458
N-ethyl-N',3-dimethylhex-3-ene-1,6-diamine (PubChem CID 91413458) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N-ethyl-N',3-dimethylhex-3-ene-1,6-diamine.
| Compound Name | N-ethyl-N',3-dimethylhex-3-ene-1,6-diamine |
|---|---|
| PubChem CID | 91413458 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N-ethyl-N',3-dimethylhex-3-ene-1,6-diamine |
| SMILES | CCNCCC(C)=CCCNC |
| InChI | InChI=1S/C10H22N2/c1-4-12-9-7-10(2)6-5-8-11-3/h6,11-12H,4-5,7-9H2,1-3H3 |
| InChIKey | WWNIPDJWIRQQHD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|