C11H23NO2S — CID 106735097
(Z)-N,4-dimethyl-6-propan-2-ylsulfonylhex-3-en-1-amine (PubChem CID 106735097) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is (Z)-N,4-dimethyl-6-propan-2-ylsulfonylhex-3-en-1-amine.
| Compound Name | (Z)-N,4-dimethyl-6-propan-2-ylsulfonylhex-3-en-1-amine |
|---|---|
| PubChem CID | 106735097 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (Z)-N,4-dimethyl-6-propan-2-ylsulfonylhex-3-en-1-amine |
| SMILES | CNCC/C=C(/C)CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-10(2)15(13,14)9-7-11(3)6-5-8-12-4/h6,10,12H,5,7-9H2,1-4H3/b11-6- |
| InChIKey | BESQMBAVRAFFBH-WDZFZDKYSA-N |
| XLogP | 1.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|