C9H15N — CID 79598050
N,4-dimethylhept-3-en-6-yn-1-amine (PubChem CID 79598050) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N,4-dimethylhept-3-en-6-yn-1-amine.
| Compound Name | N,4-dimethylhept-3-en-6-yn-1-amine |
|---|---|
| PubChem CID | 79598050 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N,4-dimethylhept-3-en-6-yn-1-amine |
| SMILES | C#CCC(C)=CCCNC |
| InChI | InChI=1S/C9H15N/c1-4-6-9(2)7-5-8-10-3/h1,7,10H,5-6,8H2,2-3H3 |
| InChIKey | CJCVNCXNPPKOGP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|