C21H31N — CID 144508430
(2Z,4E,6E,7Z,10Z,13Z)-5-ethenyl-6-ethylidene-9,11-dimethylpentadeca-2,4,7,10,13-pentaen-8-amine (PubChem CID 144508430) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (2Z,4E,6E,7Z,10Z,13Z)-5-ethenyl-6-ethylidene-9,11-dimethylpentadeca-2,4,7,10,13-pentaen-8-amine.
| Compound Name | (2Z,4E,6E,7Z,10Z,13Z)-5-ethenyl-6-ethylidene-9,11-dimethylpentadeca-2,4,7,10,13-pentaen-8-amine |
|---|---|
| PubChem CID | 144508430 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (2Z,4E,6E,7Z,10Z,13Z)-5-ethenyl-6-ethylidene-9,11-dimethylpentadeca-2,4,7,10,13-pentaen-8-amine |
| SMILES | C=CC(=C\C=C/C)/C(/C=C(\N)C(C)/C=C(/C)C/C=C\C)=C/C |
| InChI | InChI=1S/C21H31N/c1-7-11-13-17(5)15-18(6)21(22)16-20(10-4)19(9-3)14-12-8-2/h7-12,14-16,18H,3,13,22H2,1-2,4-6H3/b11-7-,12-8-,17-15-,19-14+,20-10+,21-16- |
| InChIKey | BRNIJRJWPTVOIE-UIFSVGEHSA-N |
| XLogP | 6.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|