C26H34Cl2O2 — CID 144775434
chloromethane;(3Z,4Z)-3-[(3E,5Z)-3-[(Z)-3-chloroprop-1-enyl]hepta-3,5-dien-2-ylidene]-4-[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]hexane-2,5-dione (PubChem CID 144775434) has the molecular formula C26H34Cl2O2 and a molecular weight of 449.46 g/mol. Its IUPAC name is chloromethane;(3Z,4Z)-3-[(3E,5Z)-3-[(Z)-3-chloroprop-1-enyl]hepta-3,5-dien-2-ylidene]-4-[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]hexane-2,5-dione.
| Compound Name | chloromethane;(3Z,4Z)-3-[(3E,5Z)-3-[(Z)-3-chloroprop-1-enyl]hepta-3,5-dien-2-ylidene]-4-[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]hexane-2,5-dione |
|---|---|
| PubChem CID | 144775434 |
| Molecular Formula | C26H34Cl2O2 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | chloromethane;(3Z,4Z)-3-[(3E,5Z)-3-[(Z)-3-chloroprop-1-enyl]hepta-3,5-dien-2-ylidene]-4-[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]hexane-2,5-dione |
| SMILES | C=CC(=C\C=C/C)/C(C)=C(C(C)=O)/C(C(C)=O)=C(C)/C(/C=C\CCl)=C/C=C\C.CCl |
| InChI | InChI=1S/C25H31ClO2.CH3Cl/c1-8-11-14-22(10-3)18(4)24(20(6)27)25(21(7)28)19(5)23(15-12-9-2)16-13-17-26;1-2/h8-16H,3,17H2,1-2,4-7H3;1H3/b11-8-,12-9-,16-13-,22-14+,23-15+,24-18+,25-19+; |
| InChIKey | BRDYAVVUVGBAGC-NNUHEVGISA-N |
| XLogP | 7.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|