C7H11IO — CID 102203445
(2Z,5E)-6-iodo-5-methylhexa-2,5-dien-1-ol (PubChem CID 102203445) has the molecular formula C7H11IO and a molecular weight of 238.07 g/mol. Its IUPAC name is (2Z,5E)-6-iodo-5-methylhexa-2,5-dien-1-ol.
| Compound Name | (2Z,5E)-6-iodo-5-methylhexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 102203445 |
| Molecular Formula | C7H11IO |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | (2Z,5E)-6-iodo-5-methylhexa-2,5-dien-1-ol |
| SMILES | C/C(=C\I)C/C=C\CO |
| InChI | InChI=1S/C7H11IO/c1-7(6-8)4-2-3-5-9/h2-3,6,9H,4-5H2,1H3/b3-2-,7-6+ |
| InChIKey | MXWGLAVIFLUCCX-BRXUXDTNSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|