C11H22OSi — CID 102291829
(2E,5E)-5-methyl-6-trimethylsilylhepta-2,5-dien-1-ol (PubChem CID 102291829) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is (2E,5E)-5-methyl-6-trimethylsilylhepta-2,5-dien-1-ol.
| Compound Name | (2E,5E)-5-methyl-6-trimethylsilylhepta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 102291829 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2E,5E)-5-methyl-6-trimethylsilylhepta-2,5-dien-1-ol |
| SMILES | C/C(C/C=C/CO)=C(/C)[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-10(8-6-7-9-12)11(2)13(3,4)5/h6-7,12H,8-9H2,1-5H3/b7-6+,11-10+ |
| InChIKey | DAKFNKADTRYFNU-MVQNEBOGSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|