C12H24O2Si2 — CID 10587207
(E)-1,6-bis(trimethylsilyl)hex-3-ene-1,6-dione (PubChem CID 10587207) has the molecular formula C12H24O2Si2 and a molecular weight of 256.49 g/mol. Its IUPAC name is (E)-1,6-bis(trimethylsilyl)hex-3-ene-1,6-dione.
| Compound Name | (E)-1,6-bis(trimethylsilyl)hex-3-ene-1,6-dione |
|---|---|
| PubChem CID | 10587207 |
| Molecular Formula | C12H24O2Si2 |
| Molecular Weight | 256.49 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (E)-1,6-bis(trimethylsilyl)hex-3-ene-1,6-dione |
| SMILES | C[Si](C)(C)C(=O)C/C=C/CC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si2/c1-15(2,3)11(13)9-7-8-10-12(14)16(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+ |
| InChIKey | ZYMAOCAFJNOTLK-BQYQJAHWSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|