C11H24O2Si2 — CID 10705494
1,5-bis(trimethylsilyl)pentane-1,5-dione (PubChem CID 10705494) has the molecular formula C11H24O2Si2 and a molecular weight of 244.48 g/mol. Its IUPAC name is 1,5-bis(trimethylsilyl)pentane-1,5-dione.
| Compound Name | 1,5-bis(trimethylsilyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 10705494 |
| Molecular Formula | C11H24O2Si2 |
| Molecular Weight | 244.48 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1,5-bis(trimethylsilyl)pentane-1,5-dione |
| SMILES | C[Si](C)(C)C(=O)CCCC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si2/c1-14(2,3)10(12)8-7-9-11(13)15(4,5)6/h7-9H2,1-6H3 |
| InChIKey | AGWRPQHDWYMRDT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|