About ethene;hex-3-enediamide
ethene;hex-3-enediamide (PubChem CID 173451408) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is ethene;hex-3-enediamide.
Molecular Properties
| Compound Name | ethene;hex-3-enediamide |
| PubChem CID | 173451408 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethene;hex-3-enediamide |
| SMILES | C=C.NC(=O)CC=CCC(N)=O |
| InChI | InChI=1S/C6H10N2O2.C2H4/c7-5(9)3-1-2-4-6(8)10;1-2/h1-2H,3-4H2,(H2,7,9)(H2,8,10);1-2H2 |
| InChIKey | OOGUSADJMFOOQJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;hex-3-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;hex-3-enediamide?
The IUPAC name of ethene;hex-3-enediamide (CID 173451408) is ethene;hex-3-enediamide.
What is the SMILES notation for ethene;hex-3-enediamide?
The canonical SMILES for ethene;hex-3-enediamide is C=C.NC(=O)CC=CCC(N)=O.
What is the InChIKey of ethene;hex-3-enediamide?
The InChIKey is OOGUSADJMFOOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.C2H4/c7-5(9)3-1-2-4-6(8)10;1-2/h1-2H,3-4H2,(H2,7,9)(H2,8,10);1-2H2.
What are the key properties of ethene;hex-3-enediamide?
ethene;hex-3-enediamide has a molecular weight of 170.21 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;hex-3-enediamide is sourced from PubChem (CID 173451408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).