C16H27NO — CID 154015526
13,13-dimethyltetradeca-3,7,11-trienamide (PubChem CID 154015526) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 13,13-dimethyltetradeca-3,7,11-trienamide.
| Compound Name | 13,13-dimethyltetradeca-3,7,11-trienamide |
|---|---|
| PubChem CID | 154015526 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 13,13-dimethyltetradeca-3,7,11-trienamide |
| SMILES | CC(C)(C)C=CCCC=CCCC=CCC(N)=O |
| InChI | InChI=1S/C16H27NO/c1-16(2,3)14-12-10-8-6-4-5-7-9-11-13-15(17)18/h4,6,9,11-12,14H,5,7-8,10,13H2,1-3H3,(H2,17,18) |
| InChIKey | SVMABIAHTFDCCR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|