About N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide
N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide (PubChem CID 58798567) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide |
| PubChem CID | 58798567 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide |
| SMILES | CC(=O)N(CCC/C=C\C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO/c1-13(17)16(15(5,6)7)12-10-8-9-11-14(2,3)4/h9,11H,8,10,12H2,1-7H3/b11-9- |
| InChIKey | NSVPWXVYTQAOLO-LUAWRHEFSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide?
The IUPAC name of N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide (CID 58798567) is N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide.
What is the SMILES notation for N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide?
The canonical SMILES for N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide is CC(=O)N(CCC/C=C\C(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide?
The InChIKey is NSVPWXVYTQAOLO-LUAWRHEFSA-N. The full InChI is InChI=1S/C15H29NO/c1-13(17)16(15(5,6)7)12-10-8-9-11-14(2,3)4/h9,11H,8,10,12H2,1-7H3/b11-9-.
What are the key properties of N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide?
N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide has a molecular weight of 239.40 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[(Z)-6,6-dimethylhept-4-enyl]acetamide is sourced from PubChem (CID 58798567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).