C12H21NO — CID 10262074
(3E,6E)-N,N-diethylocta-3,6-dienamide (PubChem CID 10262074) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3E,6E)-N,N-diethylocta-3,6-dienamide.
| Compound Name | (3E,6E)-N,N-diethylocta-3,6-dienamide |
|---|---|
| PubChem CID | 10262074 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3E,6E)-N,N-diethylocta-3,6-dienamide |
| SMILES | C/C=C/C/C=C/CC(=O)N(CC)CC |
| InChI | InChI=1S/C12H21NO/c1-4-7-8-9-10-11-12(14)13(5-2)6-3/h4,7,9-10H,5-6,8,11H2,1-3H3/b7-4+,10-9+ |
| InChIKey | ZFWKRBVWXARPKZ-OXSFDCBASA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|