C8H15NO — CID 12545744
N,N-diethylbut-3-enamide (PubChem CID 12545744) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is N,N-diethylbut-3-enamide.
| Compound Name | N,N-diethylbut-3-enamide |
|---|---|
| PubChem CID | 12545744 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N,N-diethylbut-3-enamide |
| SMILES | C=CCC(=O)N(CC)CC |
| InChI | InChI=1S/C8H15NO/c1-4-7-8(10)9(5-2)6-3/h4H,1,5-7H2,2-3H3 |
| InChIKey | LFLPVHJRYKZGND-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|