About CID 177476309
CID 177476309 (PubChem CID 177476309) has the molecular formula C4H6IO2
and a molecular weight of 212.99 g/mol.
Molecular Properties
| Compound Name | CID 177476309 |
| PubChem CID | 177476309 |
| Molecular Formula | C4H6IO2 |
| Molecular Weight | 212.99 g/mol |
| Exact Mass | 212.94 |
| IUPAC Name | — |
| SMILES | CC(=CI)CO[O] |
| InChI | InChI=1S/C4H6IO2/c1-4(2-5)3-7-6/h2H,3H2,1H3 |
| InChIKey | OUPBFLFTAUJUPG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.99 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 177476309 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177476309?
The IUPAC name of CID 177476309 (CID 177476309) is not available.
What is the SMILES notation for CID 177476309?
The canonical SMILES for CID 177476309 is CC(=CI)CO[O].
What is the InChIKey of CID 177476309?
The InChIKey is OUPBFLFTAUJUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6IO2/c1-4(2-5)3-7-6/h2H,3H2,1H3.
What are the key properties of CID 177476309?
CID 177476309 has a molecular weight of 212.99 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177476309 is sourced from PubChem (CID 177476309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).