C9H16O2 — CID 57284516
2-methylocta-2,6-diene-1,8-diol (PubChem CID 57284516) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-methylocta-2,6-diene-1,8-diol.
| Compound Name | 2-methylocta-2,6-diene-1,8-diol |
|---|---|
| PubChem CID | 57284516 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-methylocta-2,6-diene-1,8-diol |
| SMILES | CC(=CCCC=CCO)CO |
| InChI | InChI=1S/C9H16O2/c1-9(8-11)6-4-2-3-5-7-10/h3,5-6,10-11H,2,4,7-8H2,1H3 |
| InChIKey | NZAUBFJWMIAEBP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|