C18H29IO4 — CID 16757116
tert-butyl [(2Z,4S,5S,6E,9E)-11-hydroxy-2-iodo-4,7-dimethylundeca-2,6,9-trien-5-yl] carbonate (PubChem CID 16757116) has the molecular formula C18H29IO4 and a molecular weight of 436.33 g/mol. Its IUPAC name is tert-butyl [(2Z,4S,5S,6E,9E)-11-hydroxy-2-iodo-4,7-dimethylundeca-2,6,9-trien-5-yl] carbonate.
| Compound Name | tert-butyl [(2Z,4S,5S,6E,9E)-11-hydroxy-2-iodo-4,7-dimethylundeca-2,6,9-trien-5-yl] carbonate |
|---|---|
| PubChem CID | 16757116 |
| Molecular Formula | C18H29IO4 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | tert-butyl [(2Z,4S,5S,6E,9E)-11-hydroxy-2-iodo-4,7-dimethylundeca-2,6,9-trien-5-yl] carbonate |
| SMILES | C/C(I)=C/[C@H](C)[C@@H](/C=C(\C)C/C=C/CO)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29IO4/c1-13(9-7-8-10-20)11-16(14(2)12-15(3)19)22-17(21)23-18(4,5)6/h7-8,11-12,14,16,20H,9-10H2,1-6H3/b8-7+,13-11+,15-12-/t14-,16+/m0/s1 |
| InChIKey | XBSIELPZNYVTPX-FNAOBTMFSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|