About methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene
methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene (PubChem CID 142802969) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene.
Molecular Properties
| Compound Name | methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene |
| PubChem CID | 142802969 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene |
| SMILES | C.C/C=C\C(C)/C=C(/C)C1=C(C)CCCC1 |
| InChI | InChI=1S/C15H24.CH4/c1-5-8-12(2)11-14(4)15-10-7-6-9-13(15)3;/h5,8,11-12H,6-7,9-10H2,1-4H3;1H4/b8-5-,14-11-; |
| InChIKey | OZWBQWIQBQYAQQ-KAQJYSJWSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene?
The IUPAC name of methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene (CID 142802969) is methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene.
What is the SMILES notation for methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene?
The canonical SMILES for methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene is C.C/C=C\C(C)/C=C(/C)C1=C(C)CCCC1.
What is the InChIKey of methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene?
The InChIKey is OZWBQWIQBQYAQQ-KAQJYSJWSA-N. The full InChI is InChI=1S/C15H24.CH4/c1-5-8-12(2)11-14(4)15-10-7-6-9-13(15)3;/h5,8,11-12H,6-7,9-10H2,1-4H3;1H4/b8-5-,14-11-;.
What are the key properties of methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene?
methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene has a molecular weight of 220.40 g/mol, XLogP of 5.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-2-[(2Z,5Z)-4-methylhepta-2,5-dien-2-yl]cyclohexene is sourced from PubChem (CID 142802969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).