C10H18 — CID 5365812
(6E)-3,5-dimethylocta-1,6-diene (PubChem CID 5365812) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (6E)-3,5-dimethylocta-1,6-diene.
| Compound Name | (6E)-3,5-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 5365812 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (6E)-3,5-dimethylocta-1,6-diene |
| SMILES | C=CC(C)CC(C)/C=C/C |
| InChI | InChI=1S/C10H18/c1-5-7-10(4)8-9(3)6-2/h5-7,9-10H,2,8H2,1,3-4H3/b7-5+ |
| InChIKey | PXCHPVWZZYRFBV-FNORWQNLSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|