C10H18OS — CID 13263785
(5E)-3-propan-2-ylsulfanylhepta-1,5-dien-4-ol (PubChem CID 13263785) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (5E)-3-propan-2-ylsulfanylhepta-1,5-dien-4-ol.
| Compound Name | (5E)-3-propan-2-ylsulfanylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 13263785 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (5E)-3-propan-2-ylsulfanylhepta-1,5-dien-4-ol |
| SMILES | C=CC(SC(C)C)C(O)/C=C/C |
| InChI | InChI=1S/C10H18OS/c1-5-7-9(11)10(6-2)12-8(3)4/h5-11H,2H2,1,3-4H3/b7-5+ |
| InChIKey | KVBIKYVKKHJYQL-FNORWQNLSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|