C5H11NO3 — CID 101063277
(2R,3S)-1-(hydroxyamino)pent-4-ene-2,3-diol (PubChem CID 101063277) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (2R,3S)-1-(hydroxyamino)pent-4-ene-2,3-diol.
| Compound Name | (2R,3S)-1-(hydroxyamino)pent-4-ene-2,3-diol |
|---|---|
| PubChem CID | 101063277 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (2R,3S)-1-(hydroxyamino)pent-4-ene-2,3-diol |
| SMILES | C=C[C@H](O)[C@H](O)CNO |
| InChI | InChI=1S/C5H11NO3/c1-2-4(7)5(8)3-6-9/h2,4-9H,1,3H2/t4-,5+/m0/s1 |
| InChIKey | FSUDJTXFQDOJIF-CRCLSJGQSA-N |
| XLogP | -1.13 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|